C17H18ClN3O5S2 — CID 76630698
N-(5-chloro-1,3-thiazol-2-yl)-2-(4-cyclopropylsulfonylphenyl)-2-(2-methoxyethoxyimino)acetamide (PubChem CID 76630698) has the molecular formula C17H18ClN3O5S2 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-2-(4-cyclopropylsulfonylphenyl)-2-(2-methoxyethoxyimino)acetamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-2-(4-cyclopropylsulfonylphenyl)-2-(2-methoxyethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630698 |
| Molecular Formula | C17H18ClN3O5S2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-2-(4-cyclopropylsulfonylphenyl)-2-(2-methoxyethoxyimino)acetamide |
| SMILES | COCCON=C(C(=O)Nc1ncc(Cl)s1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H18ClN3O5S2/c1-25-8-9-26-21-15(16(22)20-17-19-10-14(18)27-17)11-2-4-12(5-3-11)28(23,24)13-6-7-13/h2-5,10,13H,6-9H2,1H3,(H,19,20,22) |
| InChIKey | HWQJVDCFBXBHRP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|