C19H22FN3O6S2 — CID 91180641
2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2S)-2-(methoxymethoxy)propoxy]iminoacetamide (PubChem CID 91180641) has the molecular formula C19H22FN3O6S2 and a molecular weight of 471.53 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2S)-2-(methoxymethoxy)propoxy]iminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2S)-2-(methoxymethoxy)propoxy]iminoacetamide |
|---|---|
| PubChem CID | 91180641 |
| Molecular Formula | C19H22FN3O6S2 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2S)-2-(methoxymethoxy)propoxy]iminoacetamide |
| SMILES | COCO[C@@H](C)CON=C(C(=O)Nc1ncc(F)s1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H22FN3O6S2/c1-12(28-11-27-2)10-29-23-17(18(24)22-19-21-9-16(20)30-19)13-3-5-14(6-4-13)31(25,26)15-7-8-15/h3-6,9,12,15H,7-8,10-11H2,1-2H3,(H,21,22,24)/t12-/m0/s1 |
| InChIKey | SDXNNVCLAYIREP-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|