C19H25N3O6S2 — CID 172965442
(2E)-2-(4-cyclopropylsulfonylphenyl)-2-(3-hydroxypropoxyimino)-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide;molecular hydrogen (PubChem CID 172965442) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfonylphenyl)-2-(3-hydroxypropoxyimino)-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide;molecular hydrogen.
| Compound Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-2-(3-hydroxypropoxyimino)-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 172965442 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-2-(3-hydroxypropoxyimino)-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide;molecular hydrogen |
| SMILES | COCc1cnc(NC(=O)/C(=N/OCCCO)c2ccc(S(=O)(=O)C3CC3)cc2)s1.[H][H] |
| InChI | InChI=1S/C19H23N3O6S2.H2/c1-27-12-14-11-20-19(29-14)21-18(24)17(22-28-10-2-9-23)13-3-5-15(6-4-13)30(25,26)16-7-8-16;/h3-6,11,16,23H,2,7-10,12H2,1H3,(H,20,21,24);1H/b22-17+; |
| InChIKey | GIGDQWCSDWLHBI-GDHRODDYSA-N |
| XLogP | 2.21 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|