C20H20N4O5S3 — CID 123739387
2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylmethoxyimino)acetamide (PubChem CID 123739387) has the molecular formula C20H20N4O5S3 and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylmethoxyimino)acetamide.
| Compound Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 123739387 |
| Molecular Formula | C20H20N4O5S3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-(1,3-thiazol-2-ylmethoxyimino)acetamide |
| SMILES | COCc1cnc(NC(=O)C(=NOCc2nccs2)c2ccc(S(O)(O)C3=CC3)cc2)s1 |
| InChI | InChI=1S/C20H20N4O5S3/c1-28-11-14-10-22-20(31-14)23-19(25)18(24-29-12-17-21-8-9-30-17)13-2-4-15(5-3-13)32(26,27)16-6-7-16/h2-6,8-10,26-27H,7,11-12H2,1H3,(H,22,23,25) |
| InChIKey | IIYQUWYRNPOVFK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|