C21H27N3O7S2 — CID 90906287
2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-2-(methoxymethoxy)propoxy]imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 90906287) has the molecular formula C21H27N3O7S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-2-(methoxymethoxy)propoxy]imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-2-(methoxymethoxy)propoxy]imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90906287 |
| Molecular Formula | C21H27N3O7S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-2-(methoxymethoxy)propoxy]imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COCO[C@H](C)CON=C(C(=O)Nc1ncc(COC)s1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H27N3O7S2/c1-14(30-13-29-3)11-31-24-19(20(25)23-21-22-10-16(32-21)12-28-2)15-4-6-17(7-5-15)33(26,27)18-8-9-18/h4-7,10,14,18H,8-9,11-13H2,1-3H3,(H,22,23,25)/t14-/m1/s1 |
| InChIKey | ORBPHDNWXHBXHR-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|