C21H25N5O6S2 — CID 76630845
N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-(1H-pyrazol-5-ylmethoxyimino)acetamide (PubChem CID 76630845) has the molecular formula C21H25N5O6S2 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-(1H-pyrazol-5-ylmethoxyimino)acetamide.
| Compound Name | N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-(1H-pyrazol-5-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630845 |
| Molecular Formula | C21H25N5O6S2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-(1H-pyrazol-5-ylmethoxyimino)acetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(C(=NOCc2ccn[nH]2)C(=O)Nc2ncc(COC)s2)cc1 |
| InChI | InChI=1S/C21H25N5O6S2/c1-30-10-3-11-34(28,29)18-6-4-15(5-7-18)19(26-32-13-16-8-9-23-25-16)20(27)24-21-22-12-17(33-21)14-31-2/h4-9,12H,3,10-11,13-14H2,1-2H3,(H,23,25)(H,22,24,27) |
| InChIKey | HHESAQKSNUQMIW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|