C18H21N7O5S2 — CID 76630256
2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethoxyimino)acetamide (PubChem CID 76630256) has the molecular formula C18H21N7O5S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethoxyimino)acetamide.
| Compound Name | 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630256 |
| Molecular Formula | C18H21N7O5S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethoxyimino)acetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(C(=NOCc2ncn[nH]2)C(=O)Nc2nc(C)ns2)cc1 |
| InChI | InChI=1S/C18H21N7O5S2/c1-12-21-18(31-25-12)22-17(26)16(24-30-10-15-19-11-20-23-15)13-4-6-14(7-5-13)32(27,28)9-3-8-29-2/h4-7,11H,3,8-10H2,1-2H3,(H,19,20,23)(H,21,22,25,26) |
| InChIKey | WQHQHTDNIRIHFT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 161.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|