C24H29N5O6S2 — CID 91588919
N-[5-(dimethylamino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91588919) has the molecular formula C24H29N5O6S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[5-(dimethylamino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-[5-(dimethylamino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91588919 |
| Molecular Formula | C24H29N5O6S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | N-[5-(dimethylamino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[4-(3-methoxypropylsulfonyl)phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(C(=NO[C@@H]2CCOC2)C(=O)Nc2nc3ccc(N(C)C)nc3s2)cc1 |
| InChI | InChI=1S/C24H29N5O6S2/c1-29(2)20-10-9-19-23(26-20)36-24(25-19)27-22(30)21(28-35-17-11-13-34-15-17)16-5-7-18(8-6-16)37(31,32)14-4-12-33-3/h5-10,17H,4,11-15H2,1-3H3,(H,25,27,30)/t17-/m1/s1 |
| InChIKey | XUGXPHAJCKZGCH-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|