C22H20N4O7S2 — CID 91423736
2-(4-cyclopropylsulfonylphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91423736) has the molecular formula C22H20N4O7S2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91423736 |
| Molecular Formula | C22H20N4O7S2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)C(=NO[C@@H]1CCOC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H20N4O7S2/c27-21(24-22-23-18-8-3-14(26(28)29)11-19(18)34-22)20(25-33-15-9-10-32-12-15)13-1-4-16(5-2-13)35(30,31)17-6-7-17/h1-5,8,11,15,17H,6-7,9-10,12H2,(H,23,24,27)/t15-/m1/s1 |
| InChIKey | HGLMDQNKUKHLLZ-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 150.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|