C23H26N6O6S2 — CID 90942609
2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 90942609) has the molecular formula C23H26N6O6S2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 90942609 |
| Molecular Formula | C23H26N6O6S2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CNCCOc1cnc2nc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C23H26N6O6S2/c1-24-9-11-34-18-12-25-20-22(26-18)36-23(27-20)28-21(30)19(29-35-15-8-10-33-13-15)14-2-4-16(5-3-14)37(31,32)17-6-7-17/h2-5,12,15,17,24H,6-11,13H2,1H3,(H,25,27,28,30)/t15-/m1/s1 |
| InChIKey | ZPVCGVUXQVLANB-OAHLLOKOSA-N |
| XLogP | 1.77 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|