C28H36N6O5S2 — CID 91445812
2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(diethylamino)ethyl-methylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91445812) has the molecular formula C28H36N6O5S2 and a molecular weight of 600.77 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(diethylamino)ethyl-methylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(diethylamino)ethyl-methylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91445812 |
| Molecular Formula | C28H36N6O5S2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(diethylamino)ethyl-methylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CCN(CC)CCN(C)c1ccc2nc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C28H36N6O5S2/c1-4-34(5-2)16-15-33(3)24-13-12-23-27(30-24)40-28(29-23)31-26(35)25(32-39-20-14-17-38-18-20)19-6-8-21(9-7-19)41(36,37)22-10-11-22/h6-9,12-13,20,22H,4-5,10-11,14-18H2,1-3H3,(H,29,31,35)/t20-/m1/s1 |
| InChIKey | PSGLCJOGSAPTBN-HXUWFJFHSA-N |
| XLogP | 3.55 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|