C24H25N3O7S2 — CID 91185236
2-(4-cyclopropylsulfonylphenyl)-N-[6-(2-hydroxyethoxy)-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91185236) has the molecular formula C24H25N3O7S2 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[6-(2-hydroxyethoxy)-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-(2-hydroxyethoxy)-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91185236 |
| Molecular Formula | C24H25N3O7S2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-(2-hydroxyethoxy)-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | O=C(Nc1nc2ccc(OCCO)cc2s1)C(=NO[C@@H]1CCOC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C24H25N3O7S2/c28-10-12-33-16-3-8-20-21(13-16)35-24(25-20)26-23(29)22(27-34-17-9-11-32-14-17)15-1-4-18(5-2-15)36(30,31)19-6-7-19/h1-5,8,13,17,19,28H,6-7,9-12,14H2,(H,25,26,29)/t17-/m1/s1 |
| InChIKey | AQFUOAYHUMLJDW-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|