C25H28N4O6S2 — CID 91241415
2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91241415) has the molecular formula C25H28N4O6S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91241415 |
| Molecular Formula | C25H28N4O6S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[6-[2-(methylamino)ethoxy]-1,3-benzothiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CNCCOc1ccc2nc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2c1 |
| InChI | InChI=1S/C25H28N4O6S2/c1-26-11-13-34-17-4-9-21-22(14-17)36-25(27-21)28-24(30)23(29-35-18-10-12-33-15-18)16-2-5-19(6-3-16)37(31,32)20-7-8-20/h2-6,9,14,18,20,26H,7-8,10-13,15H2,1H3,(H,27,28,30)/t18-/m1/s1 |
| InChIKey | HOUPKUZLDCBGLM-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|