C27H33N5O5S — CID 24998653
(2Z)-2-[4-(1-cyclopropyl-1-hydroxyethyl)phenyl]-N-[5-[3-(methylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 24998653) has the molecular formula C27H33N5O5S and a molecular weight of 539.66 g/mol. Its IUPAC name is (2Z)-2-[4-(1-cyclopropyl-1-hydroxyethyl)phenyl]-N-[5-[3-(methylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | (2Z)-2-[4-(1-cyclopropyl-1-hydroxyethyl)phenyl]-N-[5-[3-(methylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 24998653 |
| Molecular Formula | C27H33N5O5S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (2Z)-2-[4-(1-cyclopropyl-1-hydroxyethyl)phenyl]-N-[5-[3-(methylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CNCCCOc1ccc2nc(NC(=O)/C(=N\O[C@@H]3CCOC3)c3ccc(C(C)(O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C27H33N5O5S/c1-27(34,19-8-9-19)18-6-4-17(5-7-18)23(32-37-20-12-15-35-16-20)24(33)31-26-29-21-10-11-22(30-25(21)38-26)36-14-3-13-28-2/h4-7,10-11,19-20,28,34H,3,8-9,12-16H2,1-2H3,(H,29,31,33)/b32-23-/t20-,27?/m1/s1 |
| InChIKey | AFDBZZWJJLXIDY-IWXQYYDOSA-N |
| XLogP | 3.45 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|