C29H39N5O7S2 — CID 91616419
N-[5-(3-amino-3-methylbutoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1R,3R)-3-methoxycyclopentyl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide (PubChem CID 91616419) has the molecular formula C29H39N5O7S2 and a molecular weight of 633.79 g/mol. Its IUPAC name is N-[5-(3-amino-3-methylbutoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1R,3R)-3-methoxycyclopentyl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide.
| Compound Name | N-[5-(3-amino-3-methylbutoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1R,3R)-3-methoxycyclopentyl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91616419 |
| Molecular Formula | C29H39N5O7S2 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | N-[5-(3-amino-3-methylbutoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1R,3R)-3-methoxycyclopentyl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(C(=NO[C@@H]2CC[C@@H](OC)C2)C(=O)Nc2nc3ccc(OCCC(C)(C)N)nc3s2)cc1 |
| InChI | InChI=1S/C29H39N5O7S2/c1-29(2,30)14-16-40-24-13-12-23-27(32-24)42-28(31-23)33-26(35)25(34-41-21-9-8-20(18-21)39-4)19-6-10-22(11-7-19)43(36,37)17-5-15-38-3/h6-7,10-13,20-21H,5,8-9,14-18,30H2,1-4H3,(H,31,33,35)/t20-,21-/m1/s1 |
| InChIKey | ZNNBWLCLOXUHMC-NHCUHLMSSA-N |
| XLogP | 3.93 |
| TPSA | 164.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|