C21H26N4O7S — CID 90810436
2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 90810436) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 90810436 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[4-(3-methoxypropylsulfonyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(C(=NO[C@@H]2CCOC2)C(=O)Nc2cnc(OC)cn2)cc1 |
| InChI | InChI=1S/C21H26N4O7S/c1-29-9-3-11-33(27,28)17-6-4-15(5-7-17)20(25-32-16-8-10-31-14-16)21(26)24-18-12-23-19(30-2)13-22-18/h4-7,12-13,16H,3,8-11,14H2,1-2H3,(H,22,24,26)/t16-/m1/s1 |
| InChIKey | OIWFYPCDJPMRFH-MRXNPFEDSA-N |
| XLogP | 1.44 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|