C23H28N4O3S — CID 143392449
(2E)-2-(4-cyclopropylsulfanylphenyl)-N-(5-ethenylpyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide;ethane (PubChem CID 143392449) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(5-ethenylpyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide;ethane.
| Compound Name | (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(5-ethenylpyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide;ethane |
|---|---|
| PubChem CID | 143392449 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(5-ethenylpyrazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide;ethane |
| SMILES | C=Cc1cnc(NC(=O)/C(=N/O[C@@H]2CCOC2)c2ccc(SC3CC3)cc2)cn1.CC |
| InChI | InChI=1S/C21H22N4O3S.C2H6/c1-2-15-11-23-19(12-22-15)24-21(26)20(25-28-16-9-10-27-13-16)14-3-5-17(6-4-14)29-18-7-8-18;1-2/h2-6,11-12,16,18H,1,7-10,13H2,(H,23,24,26);1-2H3/b25-20+;/t16-;/m1./s1 |
| InChIKey | CKAQWIKEHTVKQE-DTWAKOFFSA-N |
| XLogP | 4.55 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|