C20H30FN3O3S2 — CID 143392611
ethane;(2E)-N-(6-fluoro-5,6-dihydro-4H-1,3-thiazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-(4-sulfanylphenyl)acetamide (PubChem CID 143392611) has the molecular formula C20H30FN3O3S2 and a molecular weight of 443.61 g/mol. Its IUPAC name is ethane;(2E)-N-(6-fluoro-5,6-dihydro-4H-1,3-thiazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-(4-sulfanylphenyl)acetamide.
| Compound Name | ethane;(2E)-N-(6-fluoro-5,6-dihydro-4H-1,3-thiazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 143392611 |
| Molecular Formula | C20H30FN3O3S2 |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | ethane;(2E)-N-(6-fluoro-5,6-dihydro-4H-1,3-thiazin-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-(4-sulfanylphenyl)acetamide |
| SMILES | CC.CC.O=C(NC1=NCCC(F)S1)/C(=N/O[C@@H]1CCOC1)c1ccc(S)cc1 |
| InChI | InChI=1S/C16H18FN3O3S2.2C2H6/c17-13-5-7-18-16(25-13)19-15(21)14(10-1-3-12(24)4-2-10)20-23-11-6-8-22-9-11;2*1-2/h1-4,11,13,24H,5-9H2,(H,18,19,21);2*1-2H3/b20-14+;;/t11-,13?;;/m1../s1 |
| InChIKey | SVKQEGKYRXJXHT-PPLUMCPESA-N |
| XLogP | 4.44 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|