C20H20BrN3O5S — CID 91242447
N-(5-bromo-2-pyridinyl)-2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91242447) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91242447 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C(=NO[C@@H]1CCOC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H20BrN3O5S/c21-14-3-8-18(22-11-14)23-20(25)19(24-29-15-9-10-28-12-15)13-1-4-16(5-2-13)30(26,27)17-6-7-17/h1-5,8,11,15,17H,6-7,9-10,12H2,(H,22,23,25)/t15-/m1/s1 |
| InChIKey | RKHMITOKIVQGRA-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|