C18H23N5O6S2 — CID 91306229
2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91306229) has the molecular formula C18H23N5O6S2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91306229 |
| Molecular Formula | C18H23N5O6S2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | Cc1nsc(NC(=O)C(=NO[C@@H]2CCOC2)c2ccc(S(=O)(=O)N(C)CCO)cc2)n1 |
| InChI | InChI=1S/C18H23N5O6S2/c1-12-19-18(30-22-12)20-17(25)16(21-29-14-7-10-28-11-14)13-3-5-15(6-4-13)31(26,27)23(2)8-9-24/h3-6,14,24H,7-11H2,1-2H3,(H,19,20,22,25)/t14-/m1/s1 |
| InChIKey | DVSJYLUQDXMJFX-CQSZACIVSA-N |
| XLogP | 0.61 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|