C20H22N6O6S2 — CID 76630990
2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-(1,3-thiazol-2-ylmethoxyimino)acetamide (PubChem CID 76630990) has the molecular formula C20H22N6O6S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-(1,3-thiazol-2-ylmethoxyimino)acetamide.
| Compound Name | 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-(1,3-thiazol-2-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630990 |
| Molecular Formula | C20H22N6O6S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methoxypyrazin-2-yl)-2-(1,3-thiazol-2-ylmethoxyimino)acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=NOCc2nccs2)C(=O)Nc2cnc(OC)cn2)cc1 |
| InChI | InChI=1S/C20H22N6O6S2/c1-30-9-7-24-34(28,29)15-5-3-14(4-6-15)19(26-32-13-18-21-8-10-33-18)20(27)25-16-11-23-17(31-2)12-22-16/h3-6,8,10-12,24H,7,9,13H2,1-2H3,(H,22,25,27) |
| InChIKey | MSSPQJBLELSJPR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|