C20H22N6O5S2 — CID 76630988
2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-2-(pyrimidin-2-ylmethoxyimino)acetamide (PubChem CID 76630988) has the molecular formula C20H22N6O5S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-2-(pyrimidin-2-ylmethoxyimino)acetamide.
| Compound Name | 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-2-(pyrimidin-2-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630988 |
| Molecular Formula | C20H22N6O5S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[4-(2-methoxyethylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-2-(pyrimidin-2-ylmethoxyimino)acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=NOCc2ncccn2)C(=O)Nc2ncc(C)s2)cc1 |
| InChI | InChI=1S/C20H22N6O5S2/c1-14-12-23-20(32-14)25-19(27)18(26-31-13-17-21-8-3-9-22-17)15-4-6-16(7-5-15)33(28,29)24-10-11-30-2/h3-9,12,24H,10-11,13H2,1-2H3,(H,23,25,27) |
| InChIKey | QVFAXICMFNSJRW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|