C23H24N4O6S2 — CID 91033963
N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]-2-(pyridin-2-ylmethoxyimino)acetamide (PubChem CID 91033963) has the molecular formula C23H24N4O6S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]-2-(pyridin-2-ylmethoxyimino)acetamide.
| Compound Name | N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]-2-(pyridin-2-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 91033963 |
| Molecular Formula | C23H24N4O6S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[5-(methoxymethyl)-1,3-thiazol-2-yl]-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]-2-(pyridin-2-ylmethoxyimino)acetamide |
| SMILES | COCc1cnc(NC(=O)C(=NOCc2ccccn2)c2ccc(S(=O)(=O)[C@H]3CCOC3)cc2)s1 |
| InChI | InChI=1S/C23H24N4O6S2/c1-31-14-18-12-25-23(34-18)26-22(28)21(27-33-13-17-4-2-3-10-24-17)16-5-7-19(8-6-16)35(29,30)20-9-11-32-15-20/h2-8,10,12,20H,9,11,13-15H2,1H3,(H,25,26,28)/t20-/m0/s1 |
| InChIKey | PTSQKVWDXQKLRA-FQEVSTJZSA-N |
| XLogP | 2.81 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|