C19H25FN3O6S2+ — CID 143392788
(2E)-N-(5-fluoro-1,3-thiazol-3-ium-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide (PubChem CID 143392788) has the molecular formula C19H25FN3O6S2+ and a molecular weight of 474.56 g/mol. Its IUPAC name is (2E)-N-(5-fluoro-1,3-thiazol-3-ium-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide.
| Compound Name | (2E)-N-(5-fluoro-1,3-thiazol-3-ium-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143392788 |
| Molecular Formula | C19H25FN3O6S2+ |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (2E)-N-(5-fluoro-1,3-thiazol-3-ium-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyimino-2-[4-(3-methoxypropylsulfonyl)phenyl]acetamide |
| SMILES | COCCCS(=O)(=O)c1ccc(/C(=N\O[C@H](C)COC)C(=O)Nc2[nH+]cc(F)s2)cc1 |
| InChI | InChI=1S/C19H24FN3O6S2/c1-13(12-28-3)29-23-17(18(24)22-19-21-11-16(20)30-19)14-5-7-15(8-6-14)31(25,26)10-4-9-27-2/h5-8,11,13H,4,9-10,12H2,1-3H3,(H,21,22,24)/p+1/b23-17+/t13-/m1/s1 |
| InChIKey | VJNYLJUHJBKWOU-MQTUIEQJSA-O |
| XLogP | 1.91 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|