C19H25FN4O6S2 — CID 91606387
2-[4-[ethyl(2-hydroxyethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetamide (PubChem CID 91606387) has the molecular formula C19H25FN4O6S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is 2-[4-[ethyl(2-hydroxyethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetamide.
| Compound Name | 2-[4-[ethyl(2-hydroxyethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91606387 |
| Molecular Formula | C19H25FN4O6S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[4-[ethyl(2-hydroxyethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetamide |
| SMILES | CCN(CCO)S(=O)(=O)c1ccc(C(=NO[C@H](C)COC)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C19H25FN4O6S2/c1-4-24(9-10-25)32(27,28)15-7-5-14(6-8-15)17(23-30-13(2)12-29-3)18(26)22-19-21-11-16(20)31-19/h5-8,11,13,25H,4,9-10,12H2,1-3H3,(H,21,22,26)/t13-/m1/s1 |
| InChIKey | FDRFQMKWJSZRNS-CYBMUJFWSA-N |
| XLogP | 1.68 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|