C17H21FN4O6S2 — CID 76631190
N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-2-(3-hydroxypropoxyimino)acetamide (PubChem CID 76631190) has the molecular formula C17H21FN4O6S2 and a molecular weight of 460.51 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-2-(3-hydroxypropoxyimino)acetamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-2-(3-hydroxypropoxyimino)acetamide |
|---|---|
| PubChem CID | 76631190 |
| Molecular Formula | C17H21FN4O6S2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[2-hydroxyethyl(methyl)sulfamoyl]phenyl]-2-(3-hydroxypropoxyimino)acetamide |
| SMILES | CN(CCO)S(=O)(=O)c1ccc(C(=NOCCCO)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C17H21FN4O6S2/c1-22(7-9-24)30(26,27)13-5-3-12(4-6-13)15(21-28-10-2-8-23)16(25)20-17-19-11-14(18)29-17/h3-6,11,23-24H,2,7-10H2,1H3,(H,19,20,25) |
| InChIKey | UFONVRFDFRWQHJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|