C15H16FN3O3S2 — CID 143392836
(2E)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(3-methoxypropoxyimino)-2-(4-sulfanylphenyl)acetamide (PubChem CID 143392836) has the molecular formula C15H16FN3O3S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (2E)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(3-methoxypropoxyimino)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | (2E)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(3-methoxypropoxyimino)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 143392836 |
| Molecular Formula | C15H16FN3O3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (2E)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(3-methoxypropoxyimino)-2-(4-sulfanylphenyl)acetamide |
| SMILES | COCCCO/N=C(/C(=O)Nc1ncc(F)s1)c1ccc(S)cc1 |
| InChI | InChI=1S/C15H16FN3O3S2/c1-21-7-2-8-22-19-13(10-3-5-11(23)6-4-10)14(20)18-15-17-9-12(16)24-15/h3-6,9,23H,2,7-8H2,1H3,(H,17,18,20)/b19-13+ |
| InChIKey | UCRQGVCTBHFUNY-CPNJWEJPSA-N |
| XLogP | 2.97 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|