C21H27N3O5S2 — CID 172937311
(2E)-2-(4-cyclopropylsulfinylphenyl)-2-(3-ethoxypropoxyimino)-N-[5-(2-hydroxyethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 172937311) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfinylphenyl)-2-(3-ethoxypropoxyimino)-N-[5-(2-hydroxyethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | (2E)-2-(4-cyclopropylsulfinylphenyl)-2-(3-ethoxypropoxyimino)-N-[5-(2-hydroxyethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 172937311 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfinylphenyl)-2-(3-ethoxypropoxyimino)-N-[5-(2-hydroxyethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCOCCCO/N=C(/C(=O)Nc1ncc(CCO)s1)c1ccc(S(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-2-28-12-3-13-29-24-19(20(26)23-21-22-14-16(30-21)10-11-25)15-4-6-17(7-5-15)31(27)18-8-9-18/h4-7,14,18,25H,2-3,8-13H2,1H3,(H,22,23,26)/b24-19+ |
| InChIKey | XWAJNLWWHSWYLE-LYBHJNIJSA-N |
| XLogP | 2.73 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|