C24H31N5O6S3 — CID 172939179
(2E)-2-(4-cyclopropylsulfinylphenyl)-2-[(3R)-oxolan-3-yl]oxyimino-N-[5-[(4-sulfamoylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 172939179) has the molecular formula C24H31N5O6S3 and a molecular weight of 581.74 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfinylphenyl)-2-[(3R)-oxolan-3-yl]oxyimino-N-[5-[(4-sulfamoylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | (2E)-2-(4-cyclopropylsulfinylphenyl)-2-[(3R)-oxolan-3-yl]oxyimino-N-[5-[(4-sulfamoylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 172939179 |
| Molecular Formula | C24H31N5O6S3 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfinylphenyl)-2-[(3R)-oxolan-3-yl]oxyimino-N-[5-[(4-sulfamoylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | NS(=O)(=O)C1CCN(Cc2cnc(NC(=O)/C(=N/O[C@@H]3CCOC3)c3ccc(S(=O)C4CC4)cc3)s2)CC1 |
| InChI | InChI=1S/C24H31N5O6S3/c25-38(32,33)21-7-10-29(11-8-21)14-18-13-26-24(36-18)27-23(30)22(28-35-17-9-12-34-15-17)16-1-3-19(4-2-16)37(31)20-5-6-20/h1-4,13,17,20-21H,5-12,14-15H2,(H2,25,32,33)(H,26,27,30)/b28-22+/t17-,37?/m1/s1 |
| InChIKey | MJKIPSAMBUEDLP-MYKOGXHXSA-N |
| XLogP | 1.81 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|