C23H30N6O6S2 — CID 91160463
N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-(6-methylsulfonyl-3-pyridinyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91160463) has the molecular formula C23H30N6O6S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-(6-methylsulfonyl-3-pyridinyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-(6-methylsulfonyl-3-pyridinyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91160463 |
| Molecular Formula | C23H30N6O6S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-(6-methylsulfonyl-3-pyridinyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CC(=O)N1CCN(Cc2cnc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(C)(=O)=O)nc3)s2)C[C@@H]1C |
| InChI | InChI=1S/C23H30N6O6S2/c1-15-12-28(7-8-29(15)16(2)30)13-19-11-25-23(36-19)26-22(31)21(27-35-18-6-9-34-14-18)17-4-5-20(24-10-17)37(3,32)33/h4-5,10-11,15,18H,6-9,12-14H2,1-3H3,(H,25,26,31)/t15-,18+/m0/s1 |
| InChIKey | JOEIVHTVKSRFQW-MAUKXSAKSA-N |
| XLogP | 1.14 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|