C27H33N5O8S2 — CID 90775407
methyl 2-[(2S)-4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-2-methylpiperazin-1-yl]-2-oxoacetate (PubChem CID 90775407) has the molecular formula C27H33N5O8S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is methyl 2-[(2S)-4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-2-methylpiperazin-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(2S)-4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-2-methylpiperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 90775407 |
| Molecular Formula | C27H33N5O8S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | methyl 2-[(2S)-4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-2-methylpiperazin-1-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N1CCN(Cc2cnc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)s2)C[C@@H]1C |
| InChI | InChI=1S/C27H33N5O8S2/c1-17-14-31(10-11-32(17)25(34)26(35)38-2)15-20-13-28-27(41-20)29-24(33)23(30-40-19-9-12-39-16-19)18-3-5-21(6-4-18)42(36,37)22-7-8-22/h3-6,13,17,19,22H,7-12,14-16H2,1-2H3,(H,28,29,33)/t17-,19+/m0/s1 |
| InChIKey | UIZJTJDHRPVOQU-PKOBYXMFSA-N |
| XLogP | 1.43 |
| TPSA | 156.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|