C27H35N5O7S2 — CID 90727616
N-[5-[[(3R)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 90727616) has the molecular formula C27H35N5O7S2 and a molecular weight of 605.74 g/mol. Its IUPAC name is N-[5-[[(3R)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[5-[[(3R)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 90727616 |
| Molecular Formula | C27H35N5O7S2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | N-[5-[[(3R)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)N1CCN(Cc2cnc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)[C@H]4CCOC4)cc3)s2)C[C@H]1C |
| InChI | InChI=1S/C27H35N5O7S2/c1-18-14-31(9-10-32(18)19(2)33)15-22-13-28-27(40-22)29-26(34)25(30-39-21-7-11-37-16-21)20-3-5-23(6-4-20)41(35,36)24-8-12-38-17-24/h3-6,13,18,21,24H,7-12,14-17H2,1-2H3,(H,28,29,34)/t18-,21-,24+/m1/s1 |
| InChIKey | MGSMIURIPDHEHL-JLGINSKQSA-N |
| XLogP | 1.91 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|