C28H37N5O6S — CID 45107969
(2E)-N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[4-(4-methoxybutanoyl)phenyl]-2-[(3S)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 45107969) has the molecular formula C28H37N5O6S and a molecular weight of 571.70 g/mol. Its IUPAC name is (2E)-N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[4-(4-methoxybutanoyl)phenyl]-2-[(3S)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | (2E)-N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[4-(4-methoxybutanoyl)phenyl]-2-[(3S)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 45107969 |
| Molecular Formula | C28H37N5O6S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (2E)-N-[5-[[(3S)-4-acetyl-3-methylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]-2-[4-(4-methoxybutanoyl)phenyl]-2-[(3S)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | COCCCC(=O)c1ccc(/C(=N\O[C@H]2CCOC2)C(=O)Nc2ncc(CN3CCN(C(C)=O)[C@@H](C)C3)s2)cc1 |
| InChI | InChI=1S/C28H37N5O6S/c1-19-16-32(11-12-33(19)20(2)34)17-24-15-29-28(40-24)30-27(36)26(31-39-23-10-14-38-18-23)22-8-6-21(7-9-22)25(35)5-4-13-37-3/h6-9,15,19,23H,4-5,10-14,16-18H2,1-3H3,(H,29,30,36)/b31-26+/t19-,23-/m0/s1 |
| InChIKey | CMDRLAGPJSEHGX-DKCNGKSTSA-N |
| XLogP | 2.95 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|