C17H19N3O5S2 — CID 123739944
2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 123739944) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 123739944 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C[C@H](CO)ON=C(C(=O)Nc1nccs1)c1ccc(S(O)(O)C2=CC2)cc1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-11(10-21)25-20-15(16(22)19-17-18-8-9-26-17)12-2-4-13(5-3-12)27(23,24)14-6-7-14/h2-6,8-9,11,21,23-24H,7,10H2,1H3,(H,18,19,22)/t11-/m1/s1 |
| InChIKey | UKFFDWIJCYXWLE-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|