C20H18N4O4S2 — CID 76630210
2-(4-cyclopropylsulfonylphenyl)-2-(pyridin-3-ylmethoxyimino)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 76630210) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-2-(pyridin-3-ylmethoxyimino)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-2-(pyridin-3-ylmethoxyimino)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 76630210 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-2-(pyridin-3-ylmethoxyimino)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(=NOCc1cccnc1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H18N4O4S2/c25-19(23-20-22-10-11-29-20)18(24-28-13-14-2-1-9-21-12-14)15-3-5-16(6-4-15)30(26,27)17-7-8-17/h1-6,9-12,17H,7-8,13H2,(H,22,23,25) |
| InChIKey | OBYAPBUBFHQJFZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|