C20H22N4O5S2 — CID 76631216
2-(4-cyclopropylsulfonylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethoxyimino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 76631216) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethoxyimino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethoxyimino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 76631216 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-2-[2-(2-oxopyrrolidin-1-yl)ethoxyimino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(=NOCCN1CCCC1=O)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H22N4O5S2/c25-17-2-1-10-24(17)11-12-29-23-18(19(26)22-20-21-9-13-30-20)14-3-5-15(6-4-14)31(27,28)16-7-8-16/h3-6,9,13,16H,1-2,7-8,10-12H2,(H,21,22,26) |
| InChIKey | IKXYOLKSNHGGMZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|