C18H17N3O6S2 — CID 91570363
2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-2-oxooxolan-3-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 91570363) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-2-oxooxolan-3-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-2-oxooxolan-3-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 91570363 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-2-oxooxolan-3-yl]oxyimino-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(=NO[C@@H]1CCOC1=O)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H17N3O6S2/c22-16(20-18-19-8-10-28-18)15(21-27-14-7-9-26-17(14)23)11-1-3-12(4-2-11)29(24,25)13-5-6-13/h1-4,8,10,13-14H,5-7,9H2,(H,19,20,22)/t14-/m1/s1 |
| InChIKey | ZXCUVJSYSKMJNI-CQSZACIVSA-N |
| XLogP | 1.75 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|