C22H26N4O5S — CID 76630192
2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-(1-hydroxyethyl)pyrazin-2-yl]acetamide (PubChem CID 76630192) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-(1-hydroxyethyl)pyrazin-2-yl]acetamide.
| Compound Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-(1-hydroxyethyl)pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 76630192 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-(1-hydroxyethyl)pyrazin-2-yl]acetamide |
| SMILES | CC(O)c1cnc(NC(=O)C(=NOC2CCCC2)c2ccc(S(=O)(=O)C3CC3)cc2)cn1 |
| InChI | InChI=1S/C22H26N4O5S/c1-14(27)19-12-24-20(13-23-19)25-22(28)21(26-31-16-4-2-3-5-16)15-6-8-17(9-7-15)32(29,30)18-10-11-18/h6-9,12-14,16,18,27H,2-5,10-11H2,1H3,(H,24,25,28) |
| InChIKey | MTUPMELXWKDQEA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|