C25H29N5O4S — CID 76631230
2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)prop-1-ynyl]pyrazin-2-yl]acetamide (PubChem CID 76631230) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)prop-1-ynyl]pyrazin-2-yl]acetamide.
| Compound Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)prop-1-ynyl]pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 76631230 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)prop-1-ynyl]pyrazin-2-yl]acetamide |
| SMILES | CN(C)CC#Cc1cnc(NC(=O)C(=NOC2CCCC2)c2ccc(S(=O)(=O)C3CC3)cc2)cn1 |
| InChI | InChI=1S/C25H29N5O4S/c1-30(2)15-5-6-19-16-27-23(17-26-19)28-25(31)24(29-34-20-7-3-4-8-20)18-9-11-21(12-10-18)35(32,33)22-13-14-22/h9-12,16-17,20,22H,3-4,7-8,13-15H2,1-2H3,(H,27,28,31) |
| InChIKey | SYZNUNGJKOEMQX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|