C18H20N4O5S — CID 123943491
2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyimino-N-(1H-pyrazol-5-yl)acetamide (PubChem CID 123943491) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyimino-N-(1H-pyrazol-5-yl)acetamide.
| Compound Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyimino-N-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 123943491 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[4-[cyclopropen-1-yl(dihydroxy)-λ4-sulfanyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyimino-N-(1H-pyrazol-5-yl)acetamide |
| SMILES | O=C(Nc1ccn[nH]1)C(=NO[C@@H]1CCOC1)c1ccc(S(O)(O)C2=CC2)cc1 |
| InChI | InChI=1S/C18H20N4O5S/c23-18(20-16-7-9-19-21-16)17(22-27-13-8-10-26-11-13)12-1-3-14(4-2-12)28(24,25)15-5-6-15/h1-5,7,9,13,24-25H,6,8,10-11H2,(H2,19,20,21,23)/t13-/m1/s1 |
| InChIKey | LUFWAAUTMSEUEC-CYBMUJFWSA-N |
| XLogP | 2.96 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|