C18H19ClN2O6S2 — CID 91279699
(5-chloro-1,3-thiazol-2-yl) 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetate (PubChem CID 91279699) has the molecular formula C18H19ClN2O6S2 and a molecular weight of 458.95 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl) 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetate.
| Compound Name | (5-chloro-1,3-thiazol-2-yl) 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetate |
|---|---|
| PubChem CID | 91279699 |
| Molecular Formula | C18H19ClN2O6S2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl) 2-(4-cyclopropylsulfonylphenyl)-2-[(2R)-1-methoxypropan-2-yl]oxyiminoacetate |
| SMILES | COC[C@@H](C)ON=C(C(=O)Oc1ncc(Cl)s1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H19ClN2O6S2/c1-11(10-25-2)27-21-16(17(22)26-18-20-9-15(19)28-18)12-3-5-13(6-4-12)29(23,24)14-7-8-14/h3-6,9,11,14H,7-8,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | HKOSNYBYIMCFKH-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 104.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|