C14H14N2O5S — CID 76630024
methyl 2-(cyanomethoxyimino)-2-(4-cyclopropylsulfonylphenyl)acetate (PubChem CID 76630024) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is methyl 2-(cyanomethoxyimino)-2-(4-cyclopropylsulfonylphenyl)acetate.
| Compound Name | methyl 2-(cyanomethoxyimino)-2-(4-cyclopropylsulfonylphenyl)acetate |
|---|---|
| PubChem CID | 76630024 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | methyl 2-(cyanomethoxyimino)-2-(4-cyclopropylsulfonylphenyl)acetate |
| SMILES | COC(=O)C(=NOCC#N)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C14H14N2O5S/c1-20-14(17)13(16-21-9-8-15)10-2-4-11(5-3-10)22(18,19)12-6-7-12/h2-5,12H,6-7,9H2,1H3 |
| InChIKey | OJBMKFCDEOHPRL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 105.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|