C16H20N2O4S — CID 59285061
methyl (2E)-2-(4-cyclopropylsulfonylphenyl)-2-pyrrolidin-1-yliminoacetate (PubChem CID 59285061) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl (2E)-2-(4-cyclopropylsulfonylphenyl)-2-pyrrolidin-1-yliminoacetate.
| Compound Name | methyl (2E)-2-(4-cyclopropylsulfonylphenyl)-2-pyrrolidin-1-yliminoacetate |
|---|---|
| PubChem CID | 59285061 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl (2E)-2-(4-cyclopropylsulfonylphenyl)-2-pyrrolidin-1-yliminoacetate |
| SMILES | COC(=O)/C(=N/N1CCCC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-22-16(19)15(17-18-10-2-3-11-18)12-4-6-13(7-5-12)23(20,21)14-8-9-14/h4-7,14H,2-3,8-11H2,1H3/b17-15+ |
| InChIKey | JQAUJAQRQYPCDG-BMRADRMJSA-N |
| XLogP | 1.60 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|