C20H23NO4S — CID 90608691
methyl 4-(3-phenylazepan-1-yl)sulfonylbenzoate (PubChem CID 90608691) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is methyl 4-(3-phenylazepan-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-(3-phenylazepan-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 90608691 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 4-(3-phenylazepan-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCCCC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-25-20(22)17-10-12-19(13-11-17)26(23,24)21-14-6-5-9-18(15-21)16-7-3-2-4-8-16/h2-4,7-8,10-13,18H,5-6,9,14-15H2,1H3 |
| InChIKey | MNXFFJBRLQTQAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |