C19H24N2O4S2 — CID 51686303
N,N-dimethyl-4-[(3S)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 51686303) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3S)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[(3S)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 51686303 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N,N-dimethyl-4-[(3S)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)N2CCC[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-20(2)26(22,23)18-10-12-19(13-11-18)27(24,25)21-14-6-9-17(15-21)16-7-4-3-5-8-16/h3-5,7-8,10-13,17H,6,9,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | VDSGGGIYQYFIRO-QGZVFWFLSA-N |
| XLogP | 2.51 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |