C24H32N2O4S2 — CID 51716707
N-[(1R,2R)-2-methylcyclohexyl]-4-[(3R)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 51716707) has the molecular formula C24H32N2O4S2 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-4-[(3R)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-4-[(3R)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 51716707 |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-4-[(3R)-3-phenylpiperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(S(=O)(=O)N2CCC[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H32N2O4S2/c1-19-8-5-6-12-24(19)25-31(27,28)22-13-15-23(16-14-22)32(29,30)26-17-7-11-21(18-26)20-9-3-2-4-10-20/h2-4,9-10,13-16,19,21,24-25H,5-8,11-12,17-18H2,1H3/t19-,21+,24-/m1/s1 |
| InChIKey | LNSJAZRZPVZHJP-NHCICSSKSA-N |
| XLogP | 4.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |