C17H26N2O4S2 — CID 25044263
N-(2-methylcyclohexyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 25044263) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-methylcyclohexyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 25044263 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2-methylcyclohexyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CC1CCCCC1NS(=O)(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H26N2O4S2/c1-14-7-2-3-10-17(14)18-24(20,21)15-8-6-9-16(13-15)25(22,23)19-11-4-5-12-19/h6,8-9,13-14,17-18H,2-5,7,10-12H2,1H3 |
| InChIKey | UPMYBQMZSYFRIE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |