C16H26ClN3O4S2 — CID 119980208
N-methyl-1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119980208) has the molecular formula C16H26ClN3O4S2 and a molecular weight of 423.99 g/mol. Its IUPAC name is N-methyl-1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | N-methyl-1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119980208 |
| Molecular Formula | C16H26ClN3O4S2 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-methyl-1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | CNC1CCN(S(=O)(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)CC1.Cl |
| InChI | InChI=1S/C16H25N3O4S2.ClH/c1-17-14-7-11-19(12-8-14)25(22,23)16-6-4-5-15(13-16)24(20,21)18-9-2-3-10-18;/h4-6,13-14,17H,2-3,7-12H2,1H3;1H |
| InChIKey | CNNWHSOUVBUHSY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |