C21H30N2O4S — CID 9404010
1-(3-acetylphenyl)sulfonyl-N-[(1R,2S)-2-methylcyclohexyl]piperidine-4-carboxamide (PubChem CID 9404010) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-[(1R,2S)-2-methylcyclohexyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-[(1R,2S)-2-methylcyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9404010 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-[(1R,2S)-2-methylcyclohexyl]piperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)N[C@@H]3CCCC[C@@H]3C)CC2)c1 |
| InChI | InChI=1S/C21H30N2O4S/c1-15-6-3-4-9-20(15)22-21(25)17-10-12-23(13-11-17)28(26,27)19-8-5-7-18(14-19)16(2)24/h5,7-8,14-15,17,20H,3-4,6,9-13H2,1-2H3,(H,22,25)/t15-,20+/m0/s1 |
| InChIKey | IOJSYBIYRANPQO-MGPUTAFESA-N |
| XLogP | 2.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |