C25H31N3O4S — CID 51071212
N-[(1R,2R)-2-benzamidocyclohexyl]-1-(benzenesulfonyl)piperidine-4-carboxamide (PubChem CID 51071212) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-(benzenesulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(benzenesulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071212 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(benzenesulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O4S/c29-24(19-9-3-1-4-10-19)26-22-13-7-8-14-23(22)27-25(30)20-15-17-28(18-16-20)33(31,32)21-11-5-2-6-12-21/h1-6,9-12,20,22-23H,7-8,13-18H2,(H,26,29)(H,27,30)/t22-,23-/m1/s1 |
| InChIKey | NLTRNPAAJOSEAW-DHIUTWEWSA-N |
| XLogP | 2.94 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |